C13H20N2O2 — CID 67259415
1,2-diethyl-4,4-bis(prop-2-enyl)pyrazolidine-3,5-dione (PubChem CID 67259415) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1,2-diethyl-4,4-bis(prop-2-enyl)pyrazolidine-3,5-dione.
| Compound Name | 1,2-diethyl-4,4-bis(prop-2-enyl)pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 67259415 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1,2-diethyl-4,4-bis(prop-2-enyl)pyrazolidine-3,5-dione |
| SMILES | C=CCC1(CC=C)C(=O)N(CC)N(CC)C1=O |
| InChI | InChI=1S/C13H20N2O2/c1-5-9-13(10-6-2)11(16)14(7-3)15(8-4)12(13)17/h5-6H,1-2,7-10H2,3-4H3 |
| InChIKey | DAUMGOBCHKKGBE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|