About furo[3,2-d][1,3]oxazole
furo[3,2-d][1,3]oxazole (PubChem CID 67259543) has the molecular formula C5H3NO2
and a molecular weight of 109.08 g/mol. Its IUPAC name is furo[3,2-d][1,3]oxazole.
Molecular Properties
| Compound Name | furo[3,2-d][1,3]oxazole |
| PubChem CID | 67259543 |
| Molecular Formula | C5H3NO2 |
| Molecular Weight | 109.08 g/mol |
| Exact Mass | 109.02 |
| IUPAC Name | furo[3,2-d][1,3]oxazole |
| SMILES | c1cc2ncoc2o1 |
| InChI | InChI=1S/C5H3NO2/c1-2-7-5-4(1)6-3-8-5/h1-3H |
| InChIKey | PDFQBDJUCBSXOJ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 39.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.08 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze furo[3,2-d][1,3]oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furo[3,2-d][1,3]oxazole?
The IUPAC name of furo[3,2-d][1,3]oxazole (CID 67259543) is furo[3,2-d][1,3]oxazole.
What is the SMILES notation for furo[3,2-d][1,3]oxazole?
The canonical SMILES for furo[3,2-d][1,3]oxazole is c1cc2ncoc2o1.
What is the InChIKey of furo[3,2-d][1,3]oxazole?
The InChIKey is PDFQBDJUCBSXOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3NO2/c1-2-7-5-4(1)6-3-8-5/h1-3H.
What are the key properties of furo[3,2-d][1,3]oxazole?
furo[3,2-d][1,3]oxazole has a molecular weight of 109.08 g/mol, XLogP of 1.42, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furo[3,2-d][1,3]oxazole is sourced from PubChem (CID 67259543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).