About 1-(1-methylcyclohexa-2,4-dien-1-yl)-3,6-dihydro-2H-pyridine
1-(1-methylcyclohexa-2,4-dien-1-yl)-3,6-dihydro-2H-pyridine (PubChem CID 67259736) has the molecular formula C12H17N
and a molecular weight of 175.28 g/mol. Its IUPAC name is 1-(1-methylcyclohexa-2,4-dien-1-yl)-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-(1-methylcyclohexa-2,4-dien-1-yl)-3,6-dihydro-2H-pyridine |
| PubChem CID | 67259736 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 1-(1-methylcyclohexa-2,4-dien-1-yl)-3,6-dihydro-2H-pyridine |
| SMILES | CC1(N2CC=CCC2)C=CC=CC1 |
| InChI | InChI=1S/C12H17N/c1-12(8-4-2-5-9-12)13-10-6-3-7-11-13/h2-6,8H,7,9-11H2,1H3 |
| InChIKey | YYNWDKOKDLIANV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-methylcyclohexa-2,4-dien-1-yl)-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methylcyclohexa-2,4-dien-1-yl)-3,6-dihydro-2H-pyridine?
The IUPAC name of 1-(1-methylcyclohexa-2,4-dien-1-yl)-3,6-dihydro-2H-pyridine (CID 67259736) is 1-(1-methylcyclohexa-2,4-dien-1-yl)-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 1-(1-methylcyclohexa-2,4-dien-1-yl)-3,6-dihydro-2H-pyridine?
The canonical SMILES for 1-(1-methylcyclohexa-2,4-dien-1-yl)-3,6-dihydro-2H-pyridine is CC1(N2CC=CCC2)C=CC=CC1.
What is the InChIKey of 1-(1-methylcyclohexa-2,4-dien-1-yl)-3,6-dihydro-2H-pyridine?
The InChIKey is YYNWDKOKDLIANV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-12(8-4-2-5-9-12)13-10-6-3-7-11-13/h2-6,8H,7,9-11H2,1H3.
What are the key properties of 1-(1-methylcyclohexa-2,4-dien-1-yl)-3,6-dihydro-2H-pyridine?
1-(1-methylcyclohexa-2,4-dien-1-yl)-3,6-dihydro-2H-pyridine has a molecular weight of 175.28 g/mol, XLogP of 2.52, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methylcyclohexa-2,4-dien-1-yl)-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 67259736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).