About 7H-pyrrolo[3,4-g][1,3]benzoxazole
7H-pyrrolo[3,4-g][1,3]benzoxazole (PubChem CID 67259786) has the molecular formula C9H6N2O
and a molecular weight of 158.16 g/mol. Its IUPAC name is 7H-pyrrolo[3,4-g][1,3]benzoxazole.
Molecular Properties
| Compound Name | 7H-pyrrolo[3,4-g][1,3]benzoxazole |
| PubChem CID | 67259786 |
| Molecular Formula | C9H6N2O |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 7H-pyrrolo[3,4-g][1,3]benzoxazole |
| SMILES | c1nc2ccc3c[nH]cc3c2o1 |
| InChI | InChI=1S/C9H6N2O/c1-2-8-9(12-5-11-8)7-4-10-3-6(1)7/h1-5,10H |
| InChIKey | KOUWCKHSXNAMHR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7H-pyrrolo[3,4-g][1,3]benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7H-pyrrolo[3,4-g][1,3]benzoxazole?
The IUPAC name of 7H-pyrrolo[3,4-g][1,3]benzoxazole (CID 67259786) is 7H-pyrrolo[3,4-g][1,3]benzoxazole.
What is the SMILES notation for 7H-pyrrolo[3,4-g][1,3]benzoxazole?
The canonical SMILES for 7H-pyrrolo[3,4-g][1,3]benzoxazole is c1nc2ccc3c[nH]cc3c2o1.
What is the InChIKey of 7H-pyrrolo[3,4-g][1,3]benzoxazole?
The InChIKey is KOUWCKHSXNAMHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O/c1-2-8-9(12-5-11-8)7-4-10-3-6(1)7/h1-5,10H.
What are the key properties of 7H-pyrrolo[3,4-g][1,3]benzoxazole?
7H-pyrrolo[3,4-g][1,3]benzoxazole has a molecular weight of 158.16 g/mol, XLogP of 2.31, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7H-pyrrolo[3,4-g][1,3]benzoxazole is sourced from PubChem (CID 67259786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).