C18H32N4O2 — CID 67260370
3,6-bis(7-aminohept-1-en-4-yl)piperazine-2,5-dione (PubChem CID 67260370) has the molecular formula C18H32N4O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 3,6-bis(7-aminohept-1-en-4-yl)piperazine-2,5-dione.
| Compound Name | 3,6-bis(7-aminohept-1-en-4-yl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 67260370 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | 3,6-bis(7-aminohept-1-en-4-yl)piperazine-2,5-dione |
| SMILES | C=CCC(CCCN)C1NC(=O)C(C(CC=C)CCCN)NC1=O |
| InChI | InChI=1S/C18H32N4O2/c1-3-7-13(9-5-11-19)15-17(23)22-16(18(24)21-15)14(8-4-2)10-6-12-20/h3-4,13-16H,1-2,5-12,19-20H2,(H,21,24)(H,22,23) |
| InChIKey | LPIOJWLNUGTSMH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|