C9H10N4 — CID 67260942
1,2,3,4-tetrahydropyrrolo[2,1-h]pteridine (PubChem CID 67260942) has the molecular formula C9H10N4 and a molecular weight of 174.21 g/mol. Its IUPAC name is 1,2,3,4-tetrahydropyrrolo[2,1-h]pteridine.
| Compound Name | 1,2,3,4-tetrahydropyrrolo[2,1-h]pteridine |
|---|---|
| PubChem CID | 67260942 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 1,2,3,4-tetrahydropyrrolo[2,1-h]pteridine |
| SMILES | c1cc2cnc3c(n2c1)NCNC3 |
| InChI | InChI=1S/C9H10N4/c1-2-7-4-11-8-5-10-6-12-9(8)13(7)3-1/h1-4,10,12H,5-6H2 |
| InChIKey | QNDJABDNZYQITQ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 41.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |