About 1-[1,3-bis(4-bromophenoxy)propyl]-4,4-difluoropiperidine
1-[1,3-bis(4-bromophenoxy)propyl]-4,4-difluoropiperidine (PubChem CID 67261099) has the molecular formula C20H21Br2F2NO2
and a molecular weight of 505.20 g/mol. Its IUPAC name is 1-[1,3-bis(4-bromophenoxy)propyl]-4,4-difluoropiperidine.
Molecular Properties
| Compound Name | 1-[1,3-bis(4-bromophenoxy)propyl]-4,4-difluoropiperidine |
| PubChem CID | 67261099 |
| Molecular Formula | C20H21Br2F2NO2 |
| Molecular Weight | 505.20 g/mol |
| Exact Mass | 502.99 |
| IUPAC Name | 1-[1,3-bis(4-bromophenoxy)propyl]-4,4-difluoropiperidine |
| SMILES | FC1(F)CCN(C(CCOc2ccc(Br)cc2)Oc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C20H21Br2F2NO2/c21-15-1-5-17(6-2-15)26-14-9-19(25-12-10-20(23,24)11-13-25)27-18-7-3-16(22)4-8-18/h1-8,19H,9-14H2 |
| InChIKey | JZSWBIZDHXJXON-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.20 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1,3-bis(4-bromophenoxy)propyl]-4,4-difluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1,3-bis(4-bromophenoxy)propyl]-4,4-difluoropiperidine?
The IUPAC name of 1-[1,3-bis(4-bromophenoxy)propyl]-4,4-difluoropiperidine (CID 67261099) is 1-[1,3-bis(4-bromophenoxy)propyl]-4,4-difluoropiperidine.
What is the SMILES notation for 1-[1,3-bis(4-bromophenoxy)propyl]-4,4-difluoropiperidine?
The canonical SMILES for 1-[1,3-bis(4-bromophenoxy)propyl]-4,4-difluoropiperidine is FC1(F)CCN(C(CCOc2ccc(Br)cc2)Oc2ccc(Br)cc2)CC1.
What is the InChIKey of 1-[1,3-bis(4-bromophenoxy)propyl]-4,4-difluoropiperidine?
The InChIKey is JZSWBIZDHXJXON-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21Br2F2NO2/c21-15-1-5-17(6-2-15)26-14-9-19(25-12-10-20(23,24)11-13-25)27-18-7-3-16(22)4-8-18/h1-8,19H,9-14H2.
What are the key properties of 1-[1,3-bis(4-bromophenoxy)propyl]-4,4-difluoropiperidine?
1-[1,3-bis(4-bromophenoxy)propyl]-4,4-difluoropiperidine has a molecular weight of 505.20 g/mol, XLogP of 6.12, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1,3-bis(4-bromophenoxy)propyl]-4,4-difluoropiperidine is sourced from PubChem (CID 67261099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).