C31H43N3O3 — CID 67261269
N-(4-hydroxybutyl)-2-oxo-N-[1-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperidin-4-yl]propanamide (PubChem CID 67261269) has the molecular formula C31H43N3O3 and a molecular weight of 505.70 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-2-oxo-N-[1-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperidin-4-yl]propanamide.
| Compound Name | N-(4-hydroxybutyl)-2-oxo-N-[1-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 67261269 |
| Molecular Formula | C31H43N3O3 |
| Molecular Weight | 505.70 g/mol |
| Exact Mass | 505.33 |
| IUPAC Name | N-(4-hydroxybutyl)-2-oxo-N-[1-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperidin-4-yl]propanamide |
| SMILES | CC(=O)C(=O)N(CCCCO)C1CCN(c2cccc(-c3ccc4c(c3)C(C)(C)CCC4(C)C)n2)CC1 |
| InChI | InChI=1S/C31H43N3O3/c1-22(36)29(37)34(17-6-7-20-35)24-13-18-33(19-14-24)28-10-8-9-27(32-28)23-11-12-25-26(21-23)31(4,5)16-15-30(25,2)3/h8-12,21,24,35H,6-7,13-20H2,1-5H3 |
| InChIKey | ALVOWZQJNORULE-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.70 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|