C9H5Cl3N2O2 — CID 67261757
3-(2,2,2-trichloroacetyl)-1,6-dihydropyrrolo[2,3-c]pyridin-7-one (PubChem CID 67261757) has the molecular formula C9H5Cl3N2O2 and a molecular weight of 279.51 g/mol. Its IUPAC name is 3-(2,2,2-trichloroacetyl)-1,6-dihydropyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 3-(2,2,2-trichloroacetyl)-1,6-dihydropyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 67261757 |
| Molecular Formula | C9H5Cl3N2O2 |
| Molecular Weight | 279.51 g/mol |
| Exact Mass | 277.94 |
| IUPAC Name | 3-(2,2,2-trichloroacetyl)-1,6-dihydropyrrolo[2,3-c]pyridin-7-one |
| SMILES | O=C(c1c[nH]c2c(=O)[nH]ccc12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H5Cl3N2O2/c10-9(11,12)7(15)5-3-14-6-4(5)1-2-13-8(6)16/h1-3,14H,(H,13,16) |
| InChIKey | DLRNPTDMWNSQSG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|