C28H38N4O2 — CID 67261790
[(2S,3S)-3-hydroxypyrrolidin-2-yl]-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]methanone (PubChem CID 67261790) has the molecular formula C28H38N4O2 and a molecular weight of 462.64 g/mol. Its IUPAC name is [(2S,3S)-3-hydroxypyrrolidin-2-yl]-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]methanone.
| Compound Name | [(2S,3S)-3-hydroxypyrrolidin-2-yl]-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 67261790 |
| Molecular Formula | C28H38N4O2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | [(2S,3S)-3-hydroxypyrrolidin-2-yl]-[4-[6-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)-2-pyridinyl]piperazin-1-yl]methanone |
| SMILES | CC1(C)CCC(C)(C)c2cc(-c3cccc(N4CCN(C(=O)[C@H]5NCC[C@@H]5O)CC4)n3)ccc21 |
| InChI | InChI=1S/C28H38N4O2/c1-27(2)11-12-28(3,4)21-18-19(8-9-20(21)27)22-6-5-7-24(30-22)31-14-16-32(17-15-31)26(34)25-23(33)10-13-29-25/h5-9,18,23,25,29,33H,10-17H2,1-4H3/t23-,25-/m0/s1 |
| InChIKey | LFRKSRSMBXLFHO-ZCYQVOJMSA-N |
| XLogP | 3.47 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |