About 3-(1,3-thiazol-2-yl)piperidine-1-sulfonamide
3-(1,3-thiazol-2-yl)piperidine-1-sulfonamide (PubChem CID 67261797) has the molecular formula C8H13N3O2S2
and a molecular weight of 247.34 g/mol. Its IUPAC name is 3-(1,3-thiazol-2-yl)piperidine-1-sulfonamide.
Molecular Properties
| Compound Name | 3-(1,3-thiazol-2-yl)piperidine-1-sulfonamide |
| PubChem CID | 67261797 |
| Molecular Formula | C8H13N3O2S2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 3-(1,3-thiazol-2-yl)piperidine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCCC(c2nccs2)C1 |
| InChI | InChI=1S/C8H13N3O2S2/c9-15(12,13)11-4-1-2-7(6-11)8-10-3-5-14-8/h3,5,7H,1-2,4,6H2,(H2,9,12,13) |
| InChIKey | BNYGQNCRMVZEOD-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,3-thiazol-2-yl)piperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-thiazol-2-yl)piperidine-1-sulfonamide?
The IUPAC name of 3-(1,3-thiazol-2-yl)piperidine-1-sulfonamide (CID 67261797) is 3-(1,3-thiazol-2-yl)piperidine-1-sulfonamide.
What is the SMILES notation for 3-(1,3-thiazol-2-yl)piperidine-1-sulfonamide?
The canonical SMILES for 3-(1,3-thiazol-2-yl)piperidine-1-sulfonamide is NS(=O)(=O)N1CCCC(c2nccs2)C1.
What is the InChIKey of 3-(1,3-thiazol-2-yl)piperidine-1-sulfonamide?
The InChIKey is BNYGQNCRMVZEOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O2S2/c9-15(12,13)11-4-1-2-7(6-11)8-10-3-5-14-8/h3,5,7H,1-2,4,6H2,(H2,9,12,13).
What are the key properties of 3-(1,3-thiazol-2-yl)piperidine-1-sulfonamide?
3-(1,3-thiazol-2-yl)piperidine-1-sulfonamide has a molecular weight of 247.34 g/mol, XLogP of 0.53, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-thiazol-2-yl)piperidine-1-sulfonamide is sourced from PubChem (CID 67261797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).