C19H23ClN4OS — CID 67262086
4-[3-(5-chlorothiophen-2-yl)-1-(2-methylpropyl)pyrazol-4-yl]-1-hydroxy-N-propylpyridin-2-imine (PubChem CID 67262086) has the molecular formula C19H23ClN4OS and a molecular weight of 390.94 g/mol. Its IUPAC name is 4-[3-(5-chlorothiophen-2-yl)-1-(2-methylpropyl)pyrazol-4-yl]-1-hydroxy-N-propylpyridin-2-imine.
| Compound Name | 4-[3-(5-chlorothiophen-2-yl)-1-(2-methylpropyl)pyrazol-4-yl]-1-hydroxy-N-propylpyridin-2-imine |
|---|---|
| PubChem CID | 67262086 |
| Molecular Formula | C19H23ClN4OS |
| Molecular Weight | 390.94 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 4-[3-(5-chlorothiophen-2-yl)-1-(2-methylpropyl)pyrazol-4-yl]-1-hydroxy-N-propylpyridin-2-imine |
| SMILES | CCC/N=c1\cc(-c2cn(CC(C)C)nc2-c2ccc(Cl)s2)ccn1O |
| InChI | InChI=1S/C19H23ClN4OS/c1-4-8-21-18-10-14(7-9-24(18)25)15-12-23(11-13(2)3)22-19(15)16-5-6-17(20)26-16/h5-7,9-10,12-13,25H,4,8,11H2,1-3H3/b21-18+ |
| InChIKey | AJPOEBRQLJAWKW-DYTRJAOYSA-N |
| XLogP | 4.94 |
| TPSA | 55.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.94 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|