C16H20INO2 — CID 67262652
6-(4-methylquinolin-1-ium-1-yl)hexanoic acid iodide (PubChem CID 67262652) has the molecular formula C16H20INO2 and a molecular weight of 385.25 g/mol. Its IUPAC name is 6-(4-methylquinolin-1-ium-1-yl)hexanoic acid iodide.
| Compound Name | 6-(4-methylquinolin-1-ium-1-yl)hexanoic acid iodide |
|---|---|
| PubChem CID | 67262652 |
| Molecular Formula | C16H20INO2 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | 6-(4-methylquinolin-1-ium-1-yl)hexanoic acid iodide |
| SMILES | Cc1cc[n+](CCCCCC(=O)O)c2ccccc12.[I-] |
| InChI | InChI=1S/C16H19NO2.HI/c1-13-10-12-17(11-6-2-3-9-16(18)19)15-8-5-4-7-14(13)15;/h4-5,7-8,10,12H,2-3,6,9,11H2,1H3;1H |
| InChIKey | KYHDQUZUDQBISD-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|