C36H45N3O6 — CID 67263097
(3S,4S,6S)-3,6-bis[amino(phenyl)methyl]-1-(2,6-dimethylphenoxy)-4-hydroxy-9-methyl-10-(2-oxo-1,3-oxazolidin-3-yl)decane-2,7-dione (PubChem CID 67263097) has the molecular formula C36H45N3O6 and a molecular weight of 615.77 g/mol. Its IUPAC name is (3S,4S,6S)-3,6-bis[amino(phenyl)methyl]-1-(2,6-dimethylphenoxy)-4-hydroxy-9-methyl-10-(2-oxo-1,3-oxazolidin-3-yl)decane-2,7-dione.
| Compound Name | (3S,4S,6S)-3,6-bis[amino(phenyl)methyl]-1-(2,6-dimethylphenoxy)-4-hydroxy-9-methyl-10-(2-oxo-1,3-oxazolidin-3-yl)decane-2,7-dione |
|---|---|
| PubChem CID | 67263097 |
| Molecular Formula | C36H45N3O6 |
| Molecular Weight | 615.77 g/mol |
| Exact Mass | 615.33 |
| IUPAC Name | (3S,4S,6S)-3,6-bis[amino(phenyl)methyl]-1-(2,6-dimethylphenoxy)-4-hydroxy-9-methyl-10-(2-oxo-1,3-oxazolidin-3-yl)decane-2,7-dione |
| SMILES | Cc1cccc(C)c1OCC(=O)[C@@H](C(N)c1ccccc1)[C@@H](O)C[C@H](C(=O)CC(C)CN1CCOC1=O)C(N)c1ccccc1 |
| InChI | InChI=1S/C36H45N3O6/c1-23(21-39-17-18-44-36(39)43)19-29(40)28(33(37)26-13-6-4-7-14-26)20-30(41)32(34(38)27-15-8-5-9-16-27)31(42)22-45-35-24(2)11-10-12-25(35)3/h4-16,23,28,30,32-34,41H,17-22,37-38H2,1-3H3/t23?,28-,30+,32+,33?,34?/m1/s1 |
| InChIKey | BANIKOSHFVKIRW-DYIWYERTSA-N |
| XLogP | 4.68 |
| TPSA | 145.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.77 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |