C13H17F3N2O — CID 67263815
7-methoxy-3-(2,2,2-trifluoroethyl)-1,2,4,5-tetrahydro-3-benzazepin-8-amine (PubChem CID 67263815) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is 7-methoxy-3-(2,2,2-trifluoroethyl)-1,2,4,5-tetrahydro-3-benzazepin-8-amine.
| Compound Name | 7-methoxy-3-(2,2,2-trifluoroethyl)-1,2,4,5-tetrahydro-3-benzazepin-8-amine |
|---|---|
| PubChem CID | 67263815 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 7-methoxy-3-(2,2,2-trifluoroethyl)-1,2,4,5-tetrahydro-3-benzazepin-8-amine |
| SMILES | COc1cc2c(cc1N)CCN(CC(F)(F)F)CC2 |
| InChI | InChI=1S/C13H17F3N2O/c1-19-12-7-10-3-5-18(8-13(14,15)16)4-2-9(10)6-11(12)17/h6-7H,2-5,8,17H2,1H3 |
| InChIKey | XDUNAGBXFWFBHZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|