C16H24N2O3 — CID 67263908
3-(1,4-dioxan-2-ylmethyl)-7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-8-amine (PubChem CID 67263908) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-(1,4-dioxan-2-ylmethyl)-7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-8-amine.
| Compound Name | 3-(1,4-dioxan-2-ylmethyl)-7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-8-amine |
|---|---|
| PubChem CID | 67263908 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 3-(1,4-dioxan-2-ylmethyl)-7-methoxy-1,2,4,5-tetrahydro-3-benzazepin-8-amine |
| SMILES | COc1cc2c(cc1N)CCN(CC1COCCO1)CC2 |
| InChI | InChI=1S/C16H24N2O3/c1-19-16-9-13-3-5-18(4-2-12(13)8-15(16)17)10-14-11-20-6-7-21-14/h8-9,14H,2-7,10-11,17H2,1H3 |
| InChIKey | JLDRJXYVBYKLND-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|