C13H18N2O — CID 67264051
10-propan-2-yl-12-oxa-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-trien-4-amine (PubChem CID 67264051) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 10-propan-2-yl-12-oxa-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-trien-4-amine.
| Compound Name | 10-propan-2-yl-12-oxa-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-trien-4-amine |
|---|---|
| PubChem CID | 67264051 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 10-propan-2-yl-12-oxa-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-trien-4-amine |
| SMILES | CC(C)N1CC2OC(C1)c1cc(N)ccc12 |
| InChI | InChI=1S/C13H18N2O/c1-8(2)15-6-12-10-4-3-9(14)5-11(10)13(7-15)16-12/h3-5,8,12-13H,6-7,14H2,1-2H3 |
| InChIKey | CCMUMBKTESFEQA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|