About 4-amino-N,5-dimethyl-1,2-oxazole-3-carboxamide
4-amino-N,5-dimethyl-1,2-oxazole-3-carboxamide (PubChem CID 67264142) has the molecular formula C6H9N3O2
and a molecular weight of 155.16 g/mol. Its IUPAC name is 4-amino-N,5-dimethyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N,5-dimethyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 67264142 |
| Molecular Formula | C6H9N3O2 |
| Molecular Weight | 155.16 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | 4-amino-N,5-dimethyl-1,2-oxazole-3-carboxamide |
| SMILES | CNC(=O)c1noc(C)c1N |
| InChI | InChI=1S/C6H9N3O2/c1-3-4(7)5(9-11-3)6(10)8-2/h7H2,1-2H3,(H,8,10) |
| InChIKey | MTRLGNGDPVOGLH-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.16 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-N,5-dimethyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N,5-dimethyl-1,2-oxazole-3-carboxamide?
The IUPAC name of 4-amino-N,5-dimethyl-1,2-oxazole-3-carboxamide (CID 67264142) is 4-amino-N,5-dimethyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 4-amino-N,5-dimethyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for 4-amino-N,5-dimethyl-1,2-oxazole-3-carboxamide is CNC(=O)c1noc(C)c1N.
What is the InChIKey of 4-amino-N,5-dimethyl-1,2-oxazole-3-carboxamide?
The InChIKey is MTRLGNGDPVOGLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O2/c1-3-4(7)5(9-11-3)6(10)8-2/h7H2,1-2H3,(H,8,10).
What are the key properties of 4-amino-N,5-dimethyl-1,2-oxazole-3-carboxamide?
4-amino-N,5-dimethyl-1,2-oxazole-3-carboxamide has a molecular weight of 155.16 g/mol, XLogP of -0.08, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N,5-dimethyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 67264142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).