About 3-[2-[2-(3,4-dimethoxyphenyl)-4-fluorophenyl]-1-pyridin-3-ylethyl]pyridine
3-[2-[2-(3,4-dimethoxyphenyl)-4-fluorophenyl]-1-pyridin-3-ylethyl]pyridine (PubChem CID 67265019) has the molecular formula C26H23FN2O2
and a molecular weight of 414.48 g/mol. Its IUPAC name is 3-[2-[2-(3,4-dimethoxyphenyl)-4-fluorophenyl]-1-pyridin-3-ylethyl]pyridine.
Molecular Properties
| Compound Name | 3-[2-[2-(3,4-dimethoxyphenyl)-4-fluorophenyl]-1-pyridin-3-ylethyl]pyridine |
| PubChem CID | 67265019 |
| Molecular Formula | C26H23FN2O2 |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 3-[2-[2-(3,4-dimethoxyphenyl)-4-fluorophenyl]-1-pyridin-3-ylethyl]pyridine |
| SMILES | COc1ccc(-c2cc(F)ccc2CC(c2cccnc2)c2cccnc2)cc1OC |
| InChI | InChI=1S/C26H23FN2O2/c1-30-25-10-8-19(14-26(25)31-2)24-15-22(27)9-7-18(24)13-23(20-5-3-11-28-16-20)21-6-4-12-29-17-21/h3-12,14-17,23H,13H2,1-2H3 |
| InChIKey | OHOUAUNMWZJXAT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-[2-(3,4-dimethoxyphenyl)-4-fluorophenyl]-1-pyridin-3-ylethyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[2-(3,4-dimethoxyphenyl)-4-fluorophenyl]-1-pyridin-3-ylethyl]pyridine?
The IUPAC name of 3-[2-[2-(3,4-dimethoxyphenyl)-4-fluorophenyl]-1-pyridin-3-ylethyl]pyridine (CID 67265019) is 3-[2-[2-(3,4-dimethoxyphenyl)-4-fluorophenyl]-1-pyridin-3-ylethyl]pyridine.
What is the SMILES notation for 3-[2-[2-(3,4-dimethoxyphenyl)-4-fluorophenyl]-1-pyridin-3-ylethyl]pyridine?
The canonical SMILES for 3-[2-[2-(3,4-dimethoxyphenyl)-4-fluorophenyl]-1-pyridin-3-ylethyl]pyridine is COc1ccc(-c2cc(F)ccc2CC(c2cccnc2)c2cccnc2)cc1OC.
What is the InChIKey of 3-[2-[2-(3,4-dimethoxyphenyl)-4-fluorophenyl]-1-pyridin-3-ylethyl]pyridine?
The InChIKey is OHOUAUNMWZJXAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H23FN2O2/c1-30-25-10-8-19(14-26(25)31-2)24-15-22(27)9-7-18(24)13-23(20-5-3-11-28-16-20)21-6-4-12-29-17-21/h3-12,14-17,23H,13H2,1-2H3.
What are the key properties of 3-[2-[2-(3,4-dimethoxyphenyl)-4-fluorophenyl]-1-pyridin-3-ylethyl]pyridine?
3-[2-[2-(3,4-dimethoxyphenyl)-4-fluorophenyl]-1-pyridin-3-ylethyl]pyridine has a molecular weight of 414.48 g/mol, XLogP of 5.67, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[2-(3,4-dimethoxyphenyl)-4-fluorophenyl]-1-pyridin-3-ylethyl]pyridine is sourced from PubChem (CID 67265019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).