C20H23BN2O3 — CID 67265133
2-(3-methoxyphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine (PubChem CID 67265133) has the molecular formula C20H23BN2O3 and a molecular weight of 350.23 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine.
| Compound Name | 2-(3-methoxyphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 67265133 |
| Molecular Formula | C20H23BN2O3 |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 2-(3-methoxyphenyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine |
| SMILES | COc1cccc(-c2cn3cc(B4OC(C)(C)C(C)(C)O4)ccc3n2)c1 |
| InChI | InChI=1S/C20H23BN2O3/c1-19(2)20(3,4)26-21(25-19)15-9-10-18-22-17(13-23(18)12-15)14-7-6-8-16(11-14)24-5/h6-13H,1-5H3 |
| InChIKey | VRDKMZHYVCWBPJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 44.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|