About 1,2-diphenylazepine
1,2-diphenylazepine (PubChem CID 67265210) has the molecular formula C18H15N
and a molecular weight of 245.33 g/mol. Its IUPAC name is 1,2-diphenylazepine.
Molecular Properties
| Compound Name | 1,2-diphenylazepine |
| PubChem CID | 67265210 |
| Molecular Formula | C18H15N |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 1,2-diphenylazepine |
| SMILES | C1=CC=C(c2ccccc2)N(c2ccccc2)C=C1 |
| InChI | InChI=1S/C18H15N/c1-4-10-16(11-5-1)18-14-8-3-9-15-19(18)17-12-6-2-7-13-17/h1-15H |
| InChIKey | KQDPOMTVWOKOES-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-diphenylazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diphenylazepine?
The IUPAC name of 1,2-diphenylazepine (CID 67265210) is 1,2-diphenylazepine.
What is the SMILES notation for 1,2-diphenylazepine?
The canonical SMILES for 1,2-diphenylazepine is C1=CC=C(c2ccccc2)N(c2ccccc2)C=C1.
What is the InChIKey of 1,2-diphenylazepine?
The InChIKey is KQDPOMTVWOKOES-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N/c1-4-10-16(11-5-1)18-14-8-3-9-15-19(18)17-12-6-2-7-13-17/h1-15H.
What are the key properties of 1,2-diphenylazepine?
1,2-diphenylazepine has a molecular weight of 245.33 g/mol, XLogP of 4.62, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diphenylazepine is sourced from PubChem (CID 67265210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).