C22H23F3O — CID 67265229
1-[7-(3,4,5-trifluorophenyl)-1,2,3,4,4a,9,10,10a-octahydrophenanthren-4-yl]ethanol (PubChem CID 67265229) has the molecular formula C22H23F3O and a molecular weight of 360.42 g/mol. Its IUPAC name is 1-[7-(3,4,5-trifluorophenyl)-1,2,3,4,4a,9,10,10a-octahydrophenanthren-4-yl]ethanol.
| Compound Name | 1-[7-(3,4,5-trifluorophenyl)-1,2,3,4,4a,9,10,10a-octahydrophenanthren-4-yl]ethanol |
|---|---|
| PubChem CID | 67265229 |
| Molecular Formula | C22H23F3O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 1-[7-(3,4,5-trifluorophenyl)-1,2,3,4,4a,9,10,10a-octahydrophenanthren-4-yl]ethanol |
| SMILES | CC(O)C1CCCC2CCc3cc(-c4cc(F)c(F)c(F)c4)ccc3C21 |
| InChI | InChI=1S/C22H23F3O/c1-12(26)17-4-2-3-13-5-6-15-9-14(7-8-18(15)21(13)17)16-10-19(23)22(25)20(24)11-16/h7-13,17,21,26H,2-6H2,1H3 |
| InChIKey | FJDYCVVGISBYOF-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|