C16H21ClO — CID 67265753
1-(7-chloro-1,2,3,4,4a,9,10,10a-octahydrophenanthren-4-yl)ethanol (PubChem CID 67265753) has the molecular formula C16H21ClO and a molecular weight of 264.80 g/mol. Its IUPAC name is 1-(7-chloro-1,2,3,4,4a,9,10,10a-octahydrophenanthren-4-yl)ethanol.
| Compound Name | 1-(7-chloro-1,2,3,4,4a,9,10,10a-octahydrophenanthren-4-yl)ethanol |
|---|---|
| PubChem CID | 67265753 |
| Molecular Formula | C16H21ClO |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 1-(7-chloro-1,2,3,4,4a,9,10,10a-octahydrophenanthren-4-yl)ethanol |
| SMILES | CC(O)C1CCCC2CCc3cc(Cl)ccc3C21 |
| InChI | InChI=1S/C16H21ClO/c1-10(18)14-4-2-3-11-5-6-12-9-13(17)7-8-15(12)16(11)14/h7-11,14,16,18H,2-6H2,1H3 |
| InChIKey | UGJRGVYLZAHOKN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |