C13H21N7O6S — CID 67265824
[7-(aminomethyl)-4-[2-(dimethylamino)ethylcarbamoyl]-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-10-yl] hydrogen sulfate (PubChem CID 67265824) has the molecular formula C13H21N7O6S and a molecular weight of 403.42 g/mol. Its IUPAC name is [7-(aminomethyl)-4-[2-(dimethylamino)ethylcarbamoyl]-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-10-yl] hydrogen sulfate.
| Compound Name | [7-(aminomethyl)-4-[2-(dimethylamino)ethylcarbamoyl]-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-10-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 67265824 |
| Molecular Formula | C13H21N7O6S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | [7-(aminomethyl)-4-[2-(dimethylamino)ethylcarbamoyl]-9-oxo-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2,5-dien-10-yl] hydrogen sulfate |
| SMILES | CN(C)CCNC(=O)n1cc2c(n1)C(CN)N1CC2N(OS(=O)(=O)O)C1=O |
| InChI | InChI=1S/C13H21N7O6S/c1-17(2)4-3-15-12(21)19-6-8-10-7-18(9(5-14)11(8)16-19)13(22)20(10)26-27(23,24)25/h6,9-10H,3-5,7,14H2,1-2H3,(H,15,21)(H,23,24,25) |
| InChIKey | PXYKWFQTXLWDTH-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 163.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|