About 1'-propan-2-ylspiro[1,2-dihydroindene-3,4'-imidazolidine]-2'-one
1'-propan-2-ylspiro[1,2-dihydroindene-3,4'-imidazolidine]-2'-one (PubChem CID 67266051) has the molecular formula C14H18N2O
and a molecular weight of 230.31 g/mol. Its IUPAC name is 1'-propan-2-ylspiro[1,2-dihydroindene-3,4'-imidazolidine]-2'-one.
Molecular Properties
| Compound Name | 1'-propan-2-ylspiro[1,2-dihydroindene-3,4'-imidazolidine]-2'-one |
| PubChem CID | 67266051 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 1'-propan-2-ylspiro[1,2-dihydroindene-3,4'-imidazolidine]-2'-one |
| SMILES | CC(C)N1CC2(CCc3ccccc32)NC1=O |
| InChI | InChI=1S/C14H18N2O/c1-10(2)16-9-14(15-13(16)17)8-7-11-5-3-4-6-12(11)14/h3-6,10H,7-9H2,1-2H3,(H,15,17) |
| InChIKey | GGCUPBPUZGSXJT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1'-propan-2-ylspiro[1,2-dihydroindene-3,4'-imidazolidine]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-propan-2-ylspiro[1,2-dihydroindene-3,4'-imidazolidine]-2'-one?
The IUPAC name of 1'-propan-2-ylspiro[1,2-dihydroindene-3,4'-imidazolidine]-2'-one (CID 67266051) is 1'-propan-2-ylspiro[1,2-dihydroindene-3,4'-imidazolidine]-2'-one.
What is the SMILES notation for 1'-propan-2-ylspiro[1,2-dihydroindene-3,4'-imidazolidine]-2'-one?
The canonical SMILES for 1'-propan-2-ylspiro[1,2-dihydroindene-3,4'-imidazolidine]-2'-one is CC(C)N1CC2(CCc3ccccc32)NC1=O.
What is the InChIKey of 1'-propan-2-ylspiro[1,2-dihydroindene-3,4'-imidazolidine]-2'-one?
The InChIKey is GGCUPBPUZGSXJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O/c1-10(2)16-9-14(15-13(16)17)8-7-11-5-3-4-6-12(11)14/h3-6,10H,7-9H2,1-2H3,(H,15,17).
What are the key properties of 1'-propan-2-ylspiro[1,2-dihydroindene-3,4'-imidazolidine]-2'-one?
1'-propan-2-ylspiro[1,2-dihydroindene-3,4'-imidazolidine]-2'-one has a molecular weight of 230.31 g/mol, XLogP of 2.26, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-propan-2-ylspiro[1,2-dihydroindene-3,4'-imidazolidine]-2'-one is sourced from PubChem (CID 67266051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).