C17H34O5Si — CID 67266113
(3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hexanoic acid (PubChem CID 67266113) has the molecular formula C17H34O5Si and a molecular weight of 346.54 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hexanoic acid.
| Compound Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hexanoic acid |
|---|---|
| PubChem CID | 67266113 |
| Molecular Formula | C17H34O5Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]hexanoic acid |
| SMILES | CCC[C@@H](O[Si](C)(C)C(C)(C)C)C(C(=O)O)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C17H34O5Si/c1-9-10-12(22-23(7,8)16(2,3)4)14(15(18)19)13-11-20-17(5,6)21-13/h12-14H,9-11H2,1-8H3,(H,18,19)/t12-,13-,14?/m1/s1 |
| InChIKey | VLGYHNGAYVWIKO-ZFXTZCCVSA-N |
| XLogP | 4.03 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|