C21H22O7 — CID 67266738
[(3R,4S)-3-(4-acetyloxy-3-methoxyphenyl)-4-hydroxy-8-methyl-3,4-dihydro-2H-chromen-7-yl] acetate (PubChem CID 67266738) has the molecular formula C21H22O7 and a molecular weight of 386.40 g/mol. Its IUPAC name is [(3R,4S)-3-(4-acetyloxy-3-methoxyphenyl)-4-hydroxy-8-methyl-3,4-dihydro-2H-chromen-7-yl] acetate.
| Compound Name | [(3R,4S)-3-(4-acetyloxy-3-methoxyphenyl)-4-hydroxy-8-methyl-3,4-dihydro-2H-chromen-7-yl] acetate |
|---|---|
| PubChem CID | 67266738 |
| Molecular Formula | C21H22O7 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | [(3R,4S)-3-(4-acetyloxy-3-methoxyphenyl)-4-hydroxy-8-methyl-3,4-dihydro-2H-chromen-7-yl] acetate |
| SMILES | COc1cc([C@@H]2COc3c(ccc(OC(C)=O)c3C)[C@H]2O)ccc1OC(C)=O |
| InChI | InChI=1S/C21H22O7/c1-11-17(27-12(2)22)8-6-15-20(24)16(10-26-21(11)15)14-5-7-18(28-13(3)23)19(9-14)25-4/h5-9,16,20,24H,10H2,1-4H3/t16-,20+/m0/s1 |
| InChIKey | SBKKUYILYDLPOU-OXJNMPFZSA-N |
| XLogP | 3.06 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|