About N-[6-(2-ethyl-1,3-dioxolan-2-yl)hexylidene]-2-methylpropane-2-sulfinamide
N-[6-(2-ethyl-1,3-dioxolan-2-yl)hexylidene]-2-methylpropane-2-sulfinamide (PubChem CID 67268344) has the molecular formula C15H29NO3S
and a molecular weight of 303.47 g/mol. Its IUPAC name is N-[6-(2-ethyl-1,3-dioxolan-2-yl)hexylidene]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | N-[6-(2-ethyl-1,3-dioxolan-2-yl)hexylidene]-2-methylpropane-2-sulfinamide |
| PubChem CID | 67268344 |
| Molecular Formula | C15H29NO3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N-[6-(2-ethyl-1,3-dioxolan-2-yl)hexylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CCC1(CCCCCC=NS(=O)C(C)(C)C)OCCO1 |
| InChI | InChI=1S/C15H29NO3S/c1-5-15(18-12-13-19-15)10-8-6-7-9-11-16-20(17)14(2,3)4/h11H,5-10,12-13H2,1-4H3 |
| InChIKey | NYUIOYSFCVJHLE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[6-(2-ethyl-1,3-dioxolan-2-yl)hexylidene]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[6-(2-ethyl-1,3-dioxolan-2-yl)hexylidene]-2-methylpropane-2-sulfinamide?
The IUPAC name of N-[6-(2-ethyl-1,3-dioxolan-2-yl)hexylidene]-2-methylpropane-2-sulfinamide (CID 67268344) is N-[6-(2-ethyl-1,3-dioxolan-2-yl)hexylidene]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for N-[6-(2-ethyl-1,3-dioxolan-2-yl)hexylidene]-2-methylpropane-2-sulfinamide?
The canonical SMILES for N-[6-(2-ethyl-1,3-dioxolan-2-yl)hexylidene]-2-methylpropane-2-sulfinamide is CCC1(CCCCCC=NS(=O)C(C)(C)C)OCCO1.
What is the InChIKey of N-[6-(2-ethyl-1,3-dioxolan-2-yl)hexylidene]-2-methylpropane-2-sulfinamide?
The InChIKey is NYUIOYSFCVJHLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29NO3S/c1-5-15(18-12-13-19-15)10-8-6-7-9-11-16-20(17)14(2,3)4/h11H,5-10,12-13H2,1-4H3.
What are the key properties of N-[6-(2-ethyl-1,3-dioxolan-2-yl)hexylidene]-2-methylpropane-2-sulfinamide?
N-[6-(2-ethyl-1,3-dioxolan-2-yl)hexylidene]-2-methylpropane-2-sulfinamide has a molecular weight of 303.47 g/mol, XLogP of 3.62, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[6-(2-ethyl-1,3-dioxolan-2-yl)hexylidene]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 67268344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).