About 1-methylpiperidin-1-ium;2,2,2-trifluoroacetate
1-methylpiperidin-1-ium;2,2,2-trifluoroacetate (PubChem CID 67268366) has the molecular formula C8H14F3NO2
and a molecular weight of 213.20 g/mol. Its IUPAC name is 1-methylpiperidin-1-ium;2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | 1-methylpiperidin-1-ium;2,2,2-trifluoroacetate |
| PubChem CID | 67268366 |
| Molecular Formula | C8H14F3NO2 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 1-methylpiperidin-1-ium;2,2,2-trifluoroacetate |
| SMILES | C[NH+]1CCCCC1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C6H13N.C2HF3O2/c1-7-5-3-2-4-6-7;3-2(4,5)1(6)7/h2-6H2,1H3;(H,6,7) |
| InChIKey | CVXUSUNJAFQWTI-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylpiperidin-1-ium;2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperidin-1-ium;2,2,2-trifluoroacetate?
The IUPAC name of 1-methylpiperidin-1-ium;2,2,2-trifluoroacetate (CID 67268366) is 1-methylpiperidin-1-ium;2,2,2-trifluoroacetate.
What is the SMILES notation for 1-methylpiperidin-1-ium;2,2,2-trifluoroacetate?
The canonical SMILES for 1-methylpiperidin-1-ium;2,2,2-trifluoroacetate is C[NH+]1CCCCC1.O=C([O-])C(F)(F)F.
What is the InChIKey of 1-methylpiperidin-1-ium;2,2,2-trifluoroacetate?
The InChIKey is CVXUSUNJAFQWTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C2HF3O2/c1-7-5-3-2-4-6-7;3-2(4,5)1(6)7/h2-6H2,1H3;(H,6,7).
What are the key properties of 1-methylpiperidin-1-ium;2,2,2-trifluoroacetate?
1-methylpiperidin-1-ium;2,2,2-trifluoroacetate has a molecular weight of 213.20 g/mol, XLogP of -1.02, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperidin-1-ium;2,2,2-trifluoroacetate is sourced from PubChem (CID 67268366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).