C25H30O5 — CID 67268706
5-[(E)-2-(7-hydroxy-4-methoxy-8,8,10a-trimethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-yl)ethenyl]benzene-1,3-diol (PubChem CID 67268706) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is 5-[(E)-2-(7-hydroxy-4-methoxy-8,8,10a-trimethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-yl)ethenyl]benzene-1,3-diol.
| Compound Name | 5-[(E)-2-(7-hydroxy-4-methoxy-8,8,10a-trimethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-yl)ethenyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 67268706 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 5-[(E)-2-(7-hydroxy-4-methoxy-8,8,10a-trimethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-yl)ethenyl]benzene-1,3-diol |
| SMILES | COc1cc(/C=C/c2cc(O)cc(O)c2)cc2c1OC1(C)CCC(O)C(C)(C)C1C2 |
| InChI | InChI=1S/C25H30O5/c1-24(2)21-13-17-9-15(5-6-16-10-18(26)14-19(27)11-16)12-20(29-4)23(17)30-25(21,3)8-7-22(24)28/h5-6,9-12,14,21-22,26-28H,7-8,13H2,1-4H3/b6-5+ |
| InChIKey | JPQMIQRRBPTDNV-AATRIKPKSA-N |
| XLogP | 4.77 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|