C30H45N3O3Si — CID 67269116
6-(2-ethyl-1,3-dioxolan-2-yl)-1-[2-naphthalen-2-yl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]hexan-1-amine (PubChem CID 67269116) has the molecular formula C30H45N3O3Si and a molecular weight of 523.79 g/mol. Its IUPAC name is 6-(2-ethyl-1,3-dioxolan-2-yl)-1-[2-naphthalen-2-yl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]hexan-1-amine.
| Compound Name | 6-(2-ethyl-1,3-dioxolan-2-yl)-1-[2-naphthalen-2-yl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]hexan-1-amine |
|---|---|
| PubChem CID | 67269116 |
| Molecular Formula | C30H45N3O3Si |
| Molecular Weight | 523.79 g/mol |
| Exact Mass | 523.32 |
| IUPAC Name | 6-(2-ethyl-1,3-dioxolan-2-yl)-1-[2-naphthalen-2-yl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]hexan-1-amine |
| SMILES | CCC1(CCCCCC(N)c2cnc(-c3ccc4ccccc4c3)n2COCC[Si](C)(C)C)OCCO1 |
| InChI | InChI=1S/C30H45N3O3Si/c1-5-30(35-17-18-36-30)16-10-6-7-13-27(31)28-22-32-29(33(28)23-34-19-20-37(2,3)4)26-15-14-24-11-8-9-12-25(24)21-26/h8-9,11-12,14-15,21-22,27H,5-7,10,13,16-20,23,31H2,1-4H3 |
| InChIKey | UPPDJKUEBULHAY-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.79 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|