C26H38ClN3O2 — CID 67269146
tert-butyl 3-(4-chlorophenyl)-2-cyclooctyl-1,3,4,5,7,8-hexahydropyrazolo[3,4-d]azepine-6-carboxylate (PubChem CID 67269146) has the molecular formula C26H38ClN3O2 and a molecular weight of 460.06 g/mol. Its IUPAC name is tert-butyl 3-(4-chlorophenyl)-2-cyclooctyl-1,3,4,5,7,8-hexahydropyrazolo[3,4-d]azepine-6-carboxylate.
| Compound Name | tert-butyl 3-(4-chlorophenyl)-2-cyclooctyl-1,3,4,5,7,8-hexahydropyrazolo[3,4-d]azepine-6-carboxylate |
|---|---|
| PubChem CID | 67269146 |
| Molecular Formula | C26H38ClN3O2 |
| Molecular Weight | 460.06 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | tert-butyl 3-(4-chlorophenyl)-2-cyclooctyl-1,3,4,5,7,8-hexahydropyrazolo[3,4-d]azepine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(CC1)C(c1ccc(Cl)cc1)N(C1CCCCCCC1)N2 |
| InChI | InChI=1S/C26H38ClN3O2/c1-26(2,3)32-25(31)29-17-15-22-23(16-18-29)28-30(21-9-7-5-4-6-8-10-21)24(22)19-11-13-20(27)14-12-19/h11-14,21,24,28H,4-10,15-18H2,1-3H3 |
| InChIKey | NSWRFLNANOLFIK-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.06 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |