About 1-cyclopentylpiperazine;4,4-difluoropiperidine
1-cyclopentylpiperazine;4,4-difluoropiperidine (PubChem CID 67269191) has the molecular formula C14H27F2N3
and a molecular weight of 275.39 g/mol. Its IUPAC name is 1-cyclopentylpiperazine;4,4-difluoropiperidine.
Molecular Properties
| Compound Name | 1-cyclopentylpiperazine;4,4-difluoropiperidine |
| PubChem CID | 67269191 |
| Molecular Formula | C14H27F2N3 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 1-cyclopentylpiperazine;4,4-difluoropiperidine |
| SMILES | C1CCC(N2CCNCC2)C1.FC1(F)CCNCC1 |
| InChI | InChI=1S/C9H18N2.C5H9F2N/c1-2-4-9(3-1)11-7-5-10-6-8-11;6-5(7)1-3-8-4-2-5/h9-10H,1-8H2;8H,1-4H2 |
| InChIKey | BTUORSOAZZEDNT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopentylpiperazine;4,4-difluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentylpiperazine;4,4-difluoropiperidine?
The IUPAC name of 1-cyclopentylpiperazine;4,4-difluoropiperidine (CID 67269191) is 1-cyclopentylpiperazine;4,4-difluoropiperidine.
What is the SMILES notation for 1-cyclopentylpiperazine;4,4-difluoropiperidine?
The canonical SMILES for 1-cyclopentylpiperazine;4,4-difluoropiperidine is C1CCC(N2CCNCC2)C1.FC1(F)CCNCC1.
What is the InChIKey of 1-cyclopentylpiperazine;4,4-difluoropiperidine?
The InChIKey is BTUORSOAZZEDNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2.C5H9F2N/c1-2-4-9(3-1)11-7-5-10-6-8-11;6-5(7)1-3-8-4-2-5/h9-10H,1-8H2;8H,1-4H2.
What are the key properties of 1-cyclopentylpiperazine;4,4-difluoropiperidine?
1-cyclopentylpiperazine;4,4-difluoropiperidine has a molecular weight of 275.39 g/mol, XLogP of 1.84, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentylpiperazine;4,4-difluoropiperidine is sourced from PubChem (CID 67269191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).