C45H55N5O4 — CID 67269253
N-(furan-2-ylmethyl)-4-phenyl-N-(7H-purin-6-yl)butanamide;[6-methyl-2-(4-methylcyclohex-3-en-1-yl)hept-5-en-2-yl] 4-phenylbutanoate (PubChem CID 67269253) has the molecular formula C45H55N5O4 and a molecular weight of 729.97 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-phenyl-N-(7H-purin-6-yl)butanamide;[6-methyl-2-(4-methylcyclohex-3-en-1-yl)hept-5-en-2-yl] 4-phenylbutanoate.
| Compound Name | N-(furan-2-ylmethyl)-4-phenyl-N-(7H-purin-6-yl)butanamide;[6-methyl-2-(4-methylcyclohex-3-en-1-yl)hept-5-en-2-yl] 4-phenylbutanoate |
|---|---|
| PubChem CID | 67269253 |
| Molecular Formula | C45H55N5O4 |
| Molecular Weight | 729.97 g/mol |
| Exact Mass | 729.43 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-phenyl-N-(7H-purin-6-yl)butanamide;[6-methyl-2-(4-methylcyclohex-3-en-1-yl)hept-5-en-2-yl] 4-phenylbutanoate |
| SMILES | CC(C)=CCCC(C)(OC(=O)CCCc1ccccc1)C1CC=C(C)CC1.O=C(CCCc1ccccc1)N(Cc1ccco1)c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C25H36O2.C20H19N5O2/c1-20(2)10-9-19-25(4,23-17-15-21(3)16-18-23)27-24(26)14-8-13-22-11-6-5-7-12-22;26-17(10-4-8-15-6-2-1-3-7-15)25(12-16-9-5-11-27-16)20-18-19(22-13-21-18)23-14-24-20/h5-7,10-12,15,23H,8-9,13-14,16-19H2,1-4H3;1-3,5-7,9,11,13-14H,4,8,10,12H2,(H,21,22,23,24) |
| InChIKey | ZZHMOORRDOMQPM-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 114.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.97 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|