About 1-cyclohexylpiperazine;2-propan-2-ylpyrrolidine
1-cyclohexylpiperazine;2-propan-2-ylpyrrolidine (PubChem CID 67269274) has the molecular formula C17H35N3
and a molecular weight of 281.49 g/mol. Its IUPAC name is 1-cyclohexylpiperazine;2-propan-2-ylpyrrolidine.
Molecular Properties
| Compound Name | 1-cyclohexylpiperazine;2-propan-2-ylpyrrolidine |
| PubChem CID | 67269274 |
| Molecular Formula | C17H35N3 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.28 |
| IUPAC Name | 1-cyclohexylpiperazine;2-propan-2-ylpyrrolidine |
| SMILES | C1CCC(N2CCNCC2)CC1.CC(C)C1CCCN1 |
| InChI | InChI=1S/C10H20N2.C7H15N/c1-2-4-10(5-3-1)12-8-6-11-7-9-12;1-6(2)7-4-3-5-8-7/h10-11H,1-9H2;6-8H,3-5H2,1-2H3 |
| InChIKey | BRPVTECEWBEBHF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclohexylpiperazine;2-propan-2-ylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylpiperazine;2-propan-2-ylpyrrolidine?
The IUPAC name of 1-cyclohexylpiperazine;2-propan-2-ylpyrrolidine (CID 67269274) is 1-cyclohexylpiperazine;2-propan-2-ylpyrrolidine.
What is the SMILES notation for 1-cyclohexylpiperazine;2-propan-2-ylpyrrolidine?
The canonical SMILES for 1-cyclohexylpiperazine;2-propan-2-ylpyrrolidine is C1CCC(N2CCNCC2)CC1.CC(C)C1CCCN1.
What is the InChIKey of 1-cyclohexylpiperazine;2-propan-2-ylpyrrolidine?
The InChIKey is BRPVTECEWBEBHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2.C7H15N/c1-2-4-10(5-3-1)12-8-6-11-7-9-12;1-6(2)7-4-3-5-8-7/h10-11H,1-9H2;6-8H,3-5H2,1-2H3.
What are the key properties of 1-cyclohexylpiperazine;2-propan-2-ylpyrrolidine?
1-cyclohexylpiperazine;2-propan-2-ylpyrrolidine has a molecular weight of 281.49 g/mol, XLogP of 2.62, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylpiperazine;2-propan-2-ylpyrrolidine is sourced from PubChem (CID 67269274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).