About 5-fluoro-3-(2-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-1,3-dihydroindol-2-one
5-fluoro-3-(2-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-1,3-dihydroindol-2-one (PubChem CID 67269394) has the molecular formula C19H12FN5O
and a molecular weight of 345.34 g/mol. Its IUPAC name is 5-fluoro-3-(2-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-fluoro-3-(2-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-1,3-dihydroindol-2-one |
| PubChem CID | 67269394 |
| Molecular Formula | C19H12FN5O |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 5-fluoro-3-(2-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Nc2ccc(F)cc2C1c1ncnc2nn(-c3ccccc3)cc12 |
| InChI | InChI=1S/C19H12FN5O/c20-11-6-7-15-13(8-11)16(19(26)23-15)17-14-9-25(12-4-2-1-3-5-12)24-18(14)22-10-21-17/h1-10,16H,(H,23,26) |
| InChIKey | DDJGKWLHFXNGLZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-fluoro-3-(2-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3-(2-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-1,3-dihydroindol-2-one?
The IUPAC name of 5-fluoro-3-(2-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-1,3-dihydroindol-2-one (CID 67269394) is 5-fluoro-3-(2-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-fluoro-3-(2-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-1,3-dihydroindol-2-one?
The canonical SMILES for 5-fluoro-3-(2-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-1,3-dihydroindol-2-one is O=C1Nc2ccc(F)cc2C1c1ncnc2nn(-c3ccccc3)cc12.
What is the InChIKey of 5-fluoro-3-(2-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-1,3-dihydroindol-2-one?
The InChIKey is DDJGKWLHFXNGLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12FN5O/c20-11-6-7-15-13(8-11)16(19(26)23-15)17-14-9-25(12-4-2-1-3-5-12)24-18(14)22-10-21-17/h1-10,16H,(H,23,26).
What are the key properties of 5-fluoro-3-(2-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-1,3-dihydroindol-2-one?
5-fluoro-3-(2-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-1,3-dihydroindol-2-one has a molecular weight of 345.34 g/mol, XLogP of 3.04, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3-(2-phenylpyrazolo[3,4-d]pyrimidin-4-yl)-1,3-dihydroindol-2-one is sourced from PubChem (CID 67269394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).