C36H62O7SSi2 — CID 67269501
[(1R,2R,3R,4R)-2-(benzenesulfonylmethyl)-3-[(Z)-6-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)hex-2-enyl]-4-triethylsilyloxycyclopentyl]oxy-triethylsilane (PubChem CID 67269501) has the molecular formula C36H62O7SSi2 and a molecular weight of 695.12 g/mol. Its IUPAC name is [(1R,2R,3R,4R)-2-(benzenesulfonylmethyl)-3-[(Z)-6-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)hex-2-enyl]-4-triethylsilyloxycyclopentyl]oxy-triethylsilane.
| Compound Name | [(1R,2R,3R,4R)-2-(benzenesulfonylmethyl)-3-[(Z)-6-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)hex-2-enyl]-4-triethylsilyloxycyclopentyl]oxy-triethylsilane |
|---|---|
| PubChem CID | 67269501 |
| Molecular Formula | C36H62O7SSi2 |
| Molecular Weight | 695.12 g/mol |
| Exact Mass | 694.38 |
| IUPAC Name | [(1R,2R,3R,4R)-2-(benzenesulfonylmethyl)-3-[(Z)-6-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)hex-2-enyl]-4-triethylsilyloxycyclopentyl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@@H]1C[C@@H](O[Si](CC)(CC)CC)[C@H](CS(=O)(=O)c2ccccc2)[C@H]1C/C=C\CCCC12OCC(C)(CO1)CO2 |
| InChI | InChI=1S/C36H62O7SSi2/c1-8-45(9-2,10-3)42-33-25-34(43-46(11-4,12-5)13-6)32(26-44(37,38)30-21-17-16-18-22-30)31(33)23-19-14-15-20-24-36-39-27-35(7,28-40-36)29-41-36/h14,16-19,21-22,31-34H,8-13,15,20,23-29H2,1-7H3/b19-14-/t31-,32-,33-,34-,35?,36?/m1/s1 |
| InChIKey | FXUAOCJGSHZLLB-UDWGDXSLSA-N |
| XLogP | 8.73 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.12 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|