C19H24N6OS — CID 67269625
N,4-dimethyl-5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]-2H-1,3-thiazol-3-amine (PubChem CID 67269625) has the molecular formula C19H24N6OS and a molecular weight of 384.51 g/mol. Its IUPAC name is N,4-dimethyl-5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]-2H-1,3-thiazol-3-amine.
| Compound Name | N,4-dimethyl-5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]-2H-1,3-thiazol-3-amine |
|---|---|
| PubChem CID | 67269625 |
| Molecular Formula | C19H24N6OS |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N,4-dimethyl-5-[2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]-2H-1,3-thiazol-3-amine |
| SMILES | CNN1CSC(c2ccnc(Nc3ccc(N4CCOCC4)cc3)n2)=C1C |
| InChI | InChI=1S/C19H24N6OS/c1-14-18(27-13-25(14)20-2)17-7-8-21-19(23-17)22-15-3-5-16(6-4-15)24-9-11-26-12-10-24/h3-8,20H,9-13H2,1-2H3,(H,21,22,23) |
| InChIKey | WRNPWJSSIDNYEU-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 65.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|