C17H27NO2Si — CID 67269940
4-[tert-butyl(dimethyl)silyl]-2-prop-2-enyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 67269940) has the molecular formula C17H27NO2Si and a molecular weight of 305.49 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]-2-prop-2-enyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]-2-prop-2-enyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 67269940 |
| Molecular Formula | C17H27NO2Si |
| Molecular Weight | 305.49 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]-2-prop-2-enyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | C=CCN1C(=O)C2CC=CC([Si](C)(C)C(C)(C)C)C2C1=O |
| InChI | InChI=1S/C17H27NO2Si/c1-7-11-18-15(19)12-9-8-10-13(14(12)16(18)20)21(5,6)17(2,3)4/h7-8,10,12-14H,1,9,11H2,2-6H3 |
| InChIKey | MOLRQDCZUSKPCM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|