C14H21NO2Si — CID 67270012
2-prop-2-enyl-5-trimethylsilyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 67270012) has the molecular formula C14H21NO2Si and a molecular weight of 263.41 g/mol. Its IUPAC name is 2-prop-2-enyl-5-trimethylsilyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-prop-2-enyl-5-trimethylsilyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 67270012 |
| Molecular Formula | C14H21NO2Si |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 2-prop-2-enyl-5-trimethylsilyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | C=CCN1C(=O)C2CC=C([Si](C)(C)C)CC2C1=O |
| InChI | InChI=1S/C14H21NO2Si/c1-5-8-15-13(16)11-7-6-10(18(2,3)4)9-12(11)14(15)17/h5-6,11-12H,1,7-9H2,2-4H3 |
| InChIKey | ZWMVVWQVEIMGJR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|