C6H9ClN4 — CID 67270173
4-chloro-1-methyl-2,3,5,7a-tetrahydropyrazolo[3,4-d]pyrimidine (PubChem CID 67270173) has the molecular formula C6H9ClN4 and a molecular weight of 172.62 g/mol. Its IUPAC name is 4-chloro-1-methyl-2,3,5,7a-tetrahydropyrazolo[3,4-d]pyrimidine.
| Compound Name | 4-chloro-1-methyl-2,3,5,7a-tetrahydropyrazolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 67270173 |
| Molecular Formula | C6H9ClN4 |
| Molecular Weight | 172.62 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 4-chloro-1-methyl-2,3,5,7a-tetrahydropyrazolo[3,4-d]pyrimidine |
| SMILES | CN1NCC2=C(Cl)NC=NC21 |
| InChI | InChI=1S/C6H9ClN4/c1-11-6-4(2-10-11)5(7)8-3-9-6/h3,6,10H,2H2,1H3,(H,8,9) |
| InChIKey | GIGXMEGRZLFKPS-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.62 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|