C12H17N3O — CID 67270363
4-[(N,4-dimethylanilino)methyl]-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 67270363) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is 4-[(N,4-dimethylanilino)methyl]-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | 4-[(N,4-dimethylanilino)methyl]-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 67270363 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | 4-[(N,4-dimethylanilino)methyl]-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | Cc1ccc(N(C)CC2COC(N)=N2)cc1 |
| InChI | InChI=1S/C12H17N3O/c1-9-3-5-11(6-4-9)15(2)7-10-8-16-12(13)14-10/h3-6,10H,7-8H2,1-2H3,(H2,13,14) |
| InChIKey | CGNGVXXOGSHBES-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|