About 5-cycloheptyl-1,4-diazepane
5-cycloheptyl-1,4-diazepane (PubChem CID 67270426) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 5-cycloheptyl-1,4-diazepane.
Molecular Properties
| Compound Name | 5-cycloheptyl-1,4-diazepane |
| PubChem CID | 67270426 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 5-cycloheptyl-1,4-diazepane |
| SMILES | C1CCCC(C2CCNCCN2)CC1 |
| InChI | InChI=1S/C12H24N2/c1-2-4-6-11(5-3-1)12-7-8-13-9-10-14-12/h11-14H,1-10H2 |
| InChIKey | WJWNYPADNFOIPT-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-cycloheptyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cycloheptyl-1,4-diazepane?
The IUPAC name of 5-cycloheptyl-1,4-diazepane (CID 67270426) is 5-cycloheptyl-1,4-diazepane.
What is the SMILES notation for 5-cycloheptyl-1,4-diazepane?
The canonical SMILES for 5-cycloheptyl-1,4-diazepane is C1CCCC(C2CCNCCN2)CC1.
What is the InChIKey of 5-cycloheptyl-1,4-diazepane?
The InChIKey is WJWNYPADNFOIPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c1-2-4-6-11(5-3-1)12-7-8-13-9-10-14-12/h11-14H,1-10H2.
What are the key properties of 5-cycloheptyl-1,4-diazepane?
5-cycloheptyl-1,4-diazepane has a molecular weight of 196.34 g/mol, XLogP of 1.91, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cycloheptyl-1,4-diazepane is sourced from PubChem (CID 67270426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).