About 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-1H-1,7-naphthyridin-2-one
8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-1H-1,7-naphthyridin-2-one (PubChem CID 67270610) has the molecular formula C20H11ClF2N2O
and a molecular weight of 368.77 g/mol. Its IUPAC name is 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-1H-1,7-naphthyridin-2-one.
Molecular Properties
| Compound Name | 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-1H-1,7-naphthyridin-2-one |
| PubChem CID | 67270610 |
| Molecular Formula | C20H11ClF2N2O |
| Molecular Weight | 368.77 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-1H-1,7-naphthyridin-2-one |
| SMILES | O=c1cc(-c2ccc(F)cc2F)c2ccnc(-c3ccccc3Cl)c2[nH]1 |
| InChI | InChI=1S/C20H11ClF2N2O/c21-16-4-2-1-3-14(16)19-20-13(7-8-24-19)15(10-18(26)25-20)12-6-5-11(22)9-17(12)23/h1-10H,(H,25,26) |
| InChIKey | BKHUAXXREOUNLF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.77 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-1H-1,7-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-1H-1,7-naphthyridin-2-one?
The IUPAC name of 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-1H-1,7-naphthyridin-2-one (CID 67270610) is 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-1H-1,7-naphthyridin-2-one.
What is the SMILES notation for 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-1H-1,7-naphthyridin-2-one?
The canonical SMILES for 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-1H-1,7-naphthyridin-2-one is O=c1cc(-c2ccc(F)cc2F)c2ccnc(-c3ccccc3Cl)c2[nH]1.
What is the InChIKey of 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-1H-1,7-naphthyridin-2-one?
The InChIKey is BKHUAXXREOUNLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H11ClF2N2O/c21-16-4-2-1-3-14(16)19-20-13(7-8-24-19)15(10-18(26)25-20)12-6-5-11(22)9-17(12)23/h1-10H,(H,25,26).
What are the key properties of 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-1H-1,7-naphthyridin-2-one?
8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-1H-1,7-naphthyridin-2-one has a molecular weight of 368.77 g/mol, XLogP of 5.19, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-chlorophenyl)-4-(2,4-difluorophenyl)-1H-1,7-naphthyridin-2-one is sourced from PubChem (CID 67270610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).