About tert-butyl N-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-fluoro-1-phenylbutan-2-yl]carbamate
tert-butyl N-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-fluoro-1-phenylbutan-2-yl]carbamate (PubChem CID 67270664) has the molecular formula C27H50FNO4Si2
and a molecular weight of 527.87 g/mol. Its IUPAC name is tert-butyl N-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-fluoro-1-phenylbutan-2-yl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-fluoro-1-phenylbutan-2-yl]carbamate |
| PubChem CID | 67270664 |
| Molecular Formula | C27H50FNO4Si2 |
| Molecular Weight | 527.87 g/mol |
| Exact Mass | 527.33 |
| IUPAC Name | tert-butyl N-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-fluoro-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C(F)c1ccccc1 |
| InChI | InChI=1S/C27H50FNO4Si2/c1-25(2,3)32-24(30)29-23(22(28)20-17-15-14-16-18-20)21(33-35(12,13)27(7,8)9)19-31-34(10,11)26(4,5)6/h14-18,21-23H,19H2,1-13H3,(H,29,30) |
| InChIKey | SIUXALKHTQKBCP-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 527.87 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-fluoro-1-phenylbutan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-fluoro-1-phenylbutan-2-yl]carbamate?
The IUPAC name of tert-butyl N-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-fluoro-1-phenylbutan-2-yl]carbamate (CID 67270664) is tert-butyl N-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-fluoro-1-phenylbutan-2-yl]carbamate.
What is the SMILES notation for tert-butyl N-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-fluoro-1-phenylbutan-2-yl]carbamate?
The canonical SMILES for tert-butyl N-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-fluoro-1-phenylbutan-2-yl]carbamate is CC(C)(C)OC(=O)NC(C(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C(F)c1ccccc1.
What is the InChIKey of tert-butyl N-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-fluoro-1-phenylbutan-2-yl]carbamate?
The InChIKey is SIUXALKHTQKBCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H50FNO4Si2/c1-25(2,3)32-24(30)29-23(22(28)20-17-15-14-16-18-20)21(33-35(12,13)27(7,8)9)19-31-34(10,11)26(4,5)6/h14-18,21-23H,19H2,1-13H3,(H,29,30).
What are the key properties of tert-butyl N-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-fluoro-1-phenylbutan-2-yl]carbamate?
tert-butyl N-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-fluoro-1-phenylbutan-2-yl]carbamate has a molecular weight of 527.87 g/mol, XLogP of 8.00, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-fluoro-1-phenylbutan-2-yl]carbamate is sourced from PubChem (CID 67270664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).