C27H50FNO4Si2 — CID 67270665
tert-butyl N-[(1R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-fluoro-1-phenylbutan-2-yl]carbamate (PubChem CID 67270665) has the molecular formula C27H50FNO4Si2 and a molecular weight of 527.87 g/mol. Its IUPAC name is tert-butyl N-[(1R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-fluoro-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(1R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-fluoro-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 67270665 |
| Molecular Formula | C27H50FNO4Si2 |
| Molecular Weight | 527.87 g/mol |
| Exact Mass | 527.33 |
| IUPAC Name | tert-butyl N-[(1R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-fluoro-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@H](F)c1ccccc1 |
| InChI | InChI=1S/C27H50FNO4Si2/c1-25(2,3)32-24(30)29-23(22(28)20-17-15-14-16-18-20)21(33-35(12,13)27(7,8)9)19-31-34(10,11)26(4,5)6/h14-18,21-23H,19H2,1-13H3,(H,29,30)/t21?,22-,23?/m1/s1 |
| InChIKey | SIUXALKHTQKBCP-OOMBGRCJSA-N |
| XLogP | 8.00 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.87 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|