About ethene;ethyl 7-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate
ethene;ethyl 7-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate (PubChem CID 67271280) has the molecular formula C13H21NO3
and a molecular weight of 239.31 g/mol. Its IUPAC name is ethene;ethyl 7-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate.
Molecular Properties
| Compound Name | ethene;ethyl 7-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate |
| PubChem CID | 67271280 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | ethene;ethyl 7-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate |
| SMILES | C=C.CCOC(=O)N1CC2CC(=O)CC(C2)C1 |
| InChI | InChI=1S/C11H17NO3.C2H4/c1-2-15-11(14)12-6-8-3-9(7-12)5-10(13)4-8;1-2/h8-9H,2-7H2,1H3;1-2H2 |
| InChIKey | HHZDZBCOHWIXKR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;ethyl 7-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;ethyl 7-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate?
The IUPAC name of ethene;ethyl 7-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate (CID 67271280) is ethene;ethyl 7-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate.
What is the SMILES notation for ethene;ethyl 7-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate?
The canonical SMILES for ethene;ethyl 7-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate is C=C.CCOC(=O)N1CC2CC(=O)CC(C2)C1.
What is the InChIKey of ethene;ethyl 7-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate?
The InChIKey is HHZDZBCOHWIXKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3.C2H4/c1-2-15-11(14)12-6-8-3-9(7-12)5-10(13)4-8;1-2/h8-9H,2-7H2,1H3;1-2H2.
What are the key properties of ethene;ethyl 7-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate?
ethene;ethyl 7-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate has a molecular weight of 239.31 g/mol, XLogP of 2.25, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;ethyl 7-oxo-3-azabicyclo[3.3.1]nonane-3-carboxylate is sourced from PubChem (CID 67271280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).