About 4-benzyl-3-[3-(3,5-difluorophenyl)propanoyl]-1,3-oxazolidin-2-one
4-benzyl-3-[3-(3,5-difluorophenyl)propanoyl]-1,3-oxazolidin-2-one (PubChem CID 67271862) has the molecular formula C19H17F2NO3
and a molecular weight of 345.35 g/mol. Its IUPAC name is 4-benzyl-3-[3-(3,5-difluorophenyl)propanoyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 4-benzyl-3-[3-(3,5-difluorophenyl)propanoyl]-1,3-oxazolidin-2-one |
| PubChem CID | 67271862 |
| Molecular Formula | C19H17F2NO3 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 4-benzyl-3-[3-(3,5-difluorophenyl)propanoyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(CCc1cc(F)cc(F)c1)N1C(=O)OCC1Cc1ccccc1 |
| InChI | InChI=1S/C19H17F2NO3/c20-15-8-14(9-16(21)11-15)6-7-18(23)22-17(12-25-19(22)24)10-13-4-2-1-3-5-13/h1-5,8-9,11,17H,6-7,10,12H2 |
| InChIKey | OESIEFOMUOUFEB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-benzyl-3-[3-(3,5-difluorophenyl)propanoyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-3-[3-(3,5-difluorophenyl)propanoyl]-1,3-oxazolidin-2-one?
The IUPAC name of 4-benzyl-3-[3-(3,5-difluorophenyl)propanoyl]-1,3-oxazolidin-2-one (CID 67271862) is 4-benzyl-3-[3-(3,5-difluorophenyl)propanoyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for 4-benzyl-3-[3-(3,5-difluorophenyl)propanoyl]-1,3-oxazolidin-2-one?
The canonical SMILES for 4-benzyl-3-[3-(3,5-difluorophenyl)propanoyl]-1,3-oxazolidin-2-one is O=C(CCc1cc(F)cc(F)c1)N1C(=O)OCC1Cc1ccccc1.
What is the InChIKey of 4-benzyl-3-[3-(3,5-difluorophenyl)propanoyl]-1,3-oxazolidin-2-one?
The InChIKey is OESIEFOMUOUFEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F2NO3/c20-15-8-14(9-16(21)11-15)6-7-18(23)22-17(12-25-19(22)24)10-13-4-2-1-3-5-13/h1-5,8-9,11,17H,6-7,10,12H2.
What are the key properties of 4-benzyl-3-[3-(3,5-difluorophenyl)propanoyl]-1,3-oxazolidin-2-one?
4-benzyl-3-[3-(3,5-difluorophenyl)propanoyl]-1,3-oxazolidin-2-one has a molecular weight of 345.35 g/mol, XLogP of 3.49, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-3-[3-(3,5-difluorophenyl)propanoyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 67271862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).