C28H27F2N5O3 — CID 67272068
2-[(1R,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-(1,2,3,4-tetrahydroisoquinolin-3-yl)propan-2-yl]-1-N-methylpyrrolo[2,3-b]pyridine-1,3-dicarboxamide (PubChem CID 67272068) has the molecular formula C28H27F2N5O3 and a molecular weight of 519.55 g/mol. Its IUPAC name is 2-[(1R,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-(1,2,3,4-tetrahydroisoquinolin-3-yl)propan-2-yl]-1-N-methylpyrrolo[2,3-b]pyridine-1,3-dicarboxamide.
| Compound Name | 2-[(1R,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-(1,2,3,4-tetrahydroisoquinolin-3-yl)propan-2-yl]-1-N-methylpyrrolo[2,3-b]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 67272068 |
| Molecular Formula | C28H27F2N5O3 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | 2-[(1R,2S)-3-(3,5-difluorophenyl)-1-hydroxy-1-(1,2,3,4-tetrahydroisoquinolin-3-yl)propan-2-yl]-1-N-methylpyrrolo[2,3-b]pyridine-1,3-dicarboxamide |
| SMILES | CNC(=O)n1c([C@H](Cc2cc(F)cc(F)c2)[C@@H](O)C2Cc3ccccc3CN2)c(C(N)=O)c2cccnc21 |
| InChI | InChI=1S/C28H27F2N5O3/c1-32-28(38)35-24(23(26(31)37)20-7-4-8-33-27(20)35)21(11-15-9-18(29)13-19(30)10-15)25(36)22-12-16-5-2-3-6-17(16)14-34-22/h2-10,13,21-22,25,34,36H,11-12,14H2,1H3,(H2,31,37)(H,32,38)/t21-,22?,25+/m0/s1 |
| InChIKey | YPIKHLPMPSIKKU-KBOKOGPMSA-N |
| XLogP | 3.00 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |