About 2-nitro-1H-azepine
2-nitro-1H-azepine (PubChem CID 67272977) has the molecular formula C6H6N2O2
and a molecular weight of 138.13 g/mol. Its IUPAC name is 2-nitro-1H-azepine.
Molecular Properties
| Compound Name | 2-nitro-1H-azepine |
| PubChem CID | 67272977 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 2-nitro-1H-azepine |
| SMILES | O=[N+]([O-])C1=CC=CC=CN1 |
| InChI | InChI=1S/C6H6N2O2/c9-8(10)6-4-2-1-3-5-7-6/h1-5,7H |
| InChIKey | ZYZVVMWOUSFNSL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitro-1H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitro-1H-azepine?
The IUPAC name of 2-nitro-1H-azepine (CID 67272977) is 2-nitro-1H-azepine.
What is the SMILES notation for 2-nitro-1H-azepine?
The canonical SMILES for 2-nitro-1H-azepine is O=[N+]([O-])C1=CC=CC=CN1.
What is the InChIKey of 2-nitro-1H-azepine?
The InChIKey is ZYZVVMWOUSFNSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2/c9-8(10)6-4-2-1-3-5-7-6/h1-5,7H.
What are the key properties of 2-nitro-1H-azepine?
2-nitro-1H-azepine has a molecular weight of 138.13 g/mol, XLogP of 0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitro-1H-azepine is sourced from PubChem (CID 67272977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).